1,3,7-triazaspiro[4.5]decane-2,4-dione

1,3,7-triazaspiro[4.5]decane-2,4-dione - Names and Identifiers

Name	1,3,7-triazaspiro[4.5]decane-2,4-dione
Synonyms	LogP 1,3,7-Triazaspiro[4.5]decan-2,4-dione 1,3,7-triazaspiro[4.5]decane-2,4-dione 1,3,7-TRIAZA-SPIRO[4.5]DECANE-2,4-DIONE 1,3,7-Triaza-spiro[4.5]decane-2,4-dione HCl 2,4,9-triazaspiro[4.5]decane-1,3-dione hydrochloride 1,3,7-Triaza-spiro[4.5]decane-2,4-dione hydrochloride
CAS	78222-09-0
InChI	InChI=1/C7H11N3O2/c11-5-7(10-6(12)9-5)2-1-3-8-4-7/h8H,1-4H2,(H2,9,10,11,12)

1,3,7-triazaspiro[4.5]decane-2,4-dione - Physico-chemical Properties

Molecular Formula	C7H11N3O2
Molar Mass	169.18
Density	1.35±0.1 g/cm3(Predicted)
pKa	10.13±0.20(Predicted)
Storage Condition	Keep in dark place,Inert atmosphere,Room temperature
Refractive Index	1.578

1,3,7-triazaspiro[4.5]decane-2,4-dione - Introduction

1,3,7-triazaspiro[4.5]decane-2,4-dione is an organic compound with the molecular formula C9H14N4O2 and a spiro heterocyclic ring containing three nitrogen atoms and a ketone group. The compound has the following properties:

1. Appearance: colorless to light yellow solid.
2. solubility: can be dissolved in organic solvents, such as ethanol, acetone and dichloromethane.

1,3,7-triazaspiro[4.5]decane-2,4-dione has certain uses in chemical research and applications, including the following aspects:

1. as a coordination compound: the compound has multiple coordination sites and can form stable complexes with metal ions, such as iron ions, molybdenum ions, etc., for metal catalytic reactions and catalyst research.
2. spectral probe: it can be used as a fluorescent probe in biological systems, such as fluorescent labeling, cell imaging, biosensors and so on.
3. Catalyst in organic synthesis: This compound has the ability to catalyze the generation and transfer of acyloxy groups, and can be applied to some reactions in organic synthesis.

Methods for preparing 1,3,7-triazaspiro[4.5]decane-2,4-dione are generally obtained by chemical synthesis. There are various specific preparation methods, for example, the substrate imidazolone and sodium nitrite are used to react under alkaline conditions.

As for the safety information of this compound, since there is no directly relevant information for reference, further experimental studies are needed to evaluate and determine its specific toxicity and risk. During the experimental operation, the laboratory safety operation procedures should be followed, and improper treatment or disposal should not be carried out to reduce potential hazards. During use, appropriate personal protective equipment should be taken and it should be ensured that it is operated under well-ventilated conditions. In case of any discomfort or accident, seek medical help or professional advice immediately.

Last Update：2024-04-10 22:41:03